C18H23NO4S — CID 112539196
2-(benzenesulfonyl)-3-(4-ethoxy-3-methoxyphenyl)propan-1-amine (PubChem CID 112539196) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3-(4-ethoxy-3-methoxyphenyl)propan-1-amine.
| Compound Name | 2-(benzenesulfonyl)-3-(4-ethoxy-3-methoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 112539196 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-(benzenesulfonyl)-3-(4-ethoxy-3-methoxyphenyl)propan-1-amine |
| SMILES | CCOc1ccc(CC(CN)S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C18H23NO4S/c1-3-23-17-10-9-14(12-18(17)22-2)11-16(13-19)24(20,21)15-7-5-4-6-8-15/h4-10,12,16H,3,11,13,19H2,1-2H3 |
| InChIKey | ZHVZRPIJUAGMDG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |