C18H27N3O2 — CID 112540328
2-(2,4-diethoxyphenyl)-2-(3,4-dimethylpiperazin-1-yl)acetonitrile (PubChem CID 112540328) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 2-(2,4-diethoxyphenyl)-2-(3,4-dimethylpiperazin-1-yl)acetonitrile.
| Compound Name | 2-(2,4-diethoxyphenyl)-2-(3,4-dimethylpiperazin-1-yl)acetonitrile |
|---|---|
| PubChem CID | 112540328 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 2-(2,4-diethoxyphenyl)-2-(3,4-dimethylpiperazin-1-yl)acetonitrile |
| SMILES | CCOc1ccc(C(C#N)N2CCN(C)C(C)C2)c(OCC)c1 |
| InChI | InChI=1S/C18H27N3O2/c1-5-22-15-7-8-16(18(11-15)23-6-2)17(12-19)21-10-9-20(4)14(3)13-21/h7-8,11,14,17H,5-6,9-10,13H2,1-4H3 |
| InChIKey | BWZMNRSARBCHLI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 48.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |