C18H28N2O4 — CID 83979590
2-(3,4-diethoxyphenyl)-2-(3,4-dimethylpiperazin-1-yl)acetic acid (PubChem CID 83979590) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-(3,4-diethoxyphenyl)-2-(3,4-dimethylpiperazin-1-yl)acetic acid.
| Compound Name | 2-(3,4-diethoxyphenyl)-2-(3,4-dimethylpiperazin-1-yl)acetic acid |
|---|---|
| PubChem CID | 83979590 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-(3,4-diethoxyphenyl)-2-(3,4-dimethylpiperazin-1-yl)acetic acid |
| SMILES | CCOc1ccc(C(C(=O)O)N2CCN(C)C(C)C2)cc1OCC |
| InChI | InChI=1S/C18H28N2O4/c1-5-23-15-8-7-14(11-16(15)24-6-2)17(18(21)22)20-10-9-19(4)13(3)12-20/h7-8,11,13,17H,5-6,9-10,12H2,1-4H3,(H,21,22) |
| InChIKey | INMAUCMLRBVLLH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |