C15H21ClN2O3 — CID 83979858
2-(3-chloro-4-ethoxyphenyl)-2-(3-methylpiperazin-1-yl)acetic acid (PubChem CID 83979858) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is 2-(3-chloro-4-ethoxyphenyl)-2-(3-methylpiperazin-1-yl)acetic acid.
| Compound Name | 2-(3-chloro-4-ethoxyphenyl)-2-(3-methylpiperazin-1-yl)acetic acid |
|---|---|
| PubChem CID | 83979858 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-(3-chloro-4-ethoxyphenyl)-2-(3-methylpiperazin-1-yl)acetic acid |
| SMILES | CCOc1ccc(C(C(=O)O)N2CCNC(C)C2)cc1Cl |
| InChI | InChI=1S/C15H21ClN2O3/c1-3-21-13-5-4-11(8-12(13)16)14(15(19)20)18-7-6-17-10(2)9-18/h4-5,8,10,14,17H,3,6-7,9H2,1-2H3,(H,19,20) |
| InChIKey | SKQWZIGJFDEOLX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |