C12H18N2O2S — CID 83979331
2-(3,4-dimethylpiperazin-1-yl)-2-thiophen-2-ylacetic acid (PubChem CID 83979331) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is 2-(3,4-dimethylpiperazin-1-yl)-2-thiophen-2-ylacetic acid.
| Compound Name | 2-(3,4-dimethylpiperazin-1-yl)-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 83979331 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-(3,4-dimethylpiperazin-1-yl)-2-thiophen-2-ylacetic acid |
| SMILES | CC1CN(C(C(=O)O)c2cccs2)CCN1C |
| InChI | InChI=1S/C12H18N2O2S/c1-9-8-14(6-5-13(9)2)11(12(15)16)10-4-3-7-17-10/h3-4,7,9,11H,5-6,8H2,1-2H3,(H,15,16) |
| InChIKey | KFNVKMOLOHNJHB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |