C19H22N6O2S — CID 1125409
2-[[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1-methylpyrrol-2-yl)methylideneamino]acetamide (PubChem CID 1125409) has the molecular formula C19H22N6O2S and a molecular weight of 398.49 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1-methylpyrrol-2-yl)methylideneamino]acetamide.
| Compound Name | 2-[[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1-methylpyrrol-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 1125409 |
| Molecular Formula | C19H22N6O2S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-[[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1-methylpyrrol-2-yl)methylideneamino]acetamide |
| SMILES | CCn1c(SCC(=O)NN=Cc2cccn2C)nnc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H22N6O2S/c1-4-25-18(14-7-9-16(27-3)10-8-14)22-23-19(25)28-13-17(26)21-20-12-15-6-5-11-24(15)2/h5-12H,4,13H2,1-3H3,(H,21,26) |
| InChIKey | SEANTDVEOMNOJU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|