C18H18BrN5O2S2 — CID 1125422
N-[(5-bromothiophen-2-yl)methylideneamino]-2-[[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 1125422) has the molecular formula C18H18BrN5O2S2 and a molecular weight of 480.41 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methylideneamino]-2-[[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methylideneamino]-2-[[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 1125422 |
| Molecular Formula | C18H18BrN5O2S2 |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methylideneamino]-2-[[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)NN=Cc2ccc(Br)s2)nnc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H18BrN5O2S2/c1-3-24-17(12-4-6-13(26-2)7-5-12)22-23-18(24)27-11-16(25)21-20-10-14-8-9-15(19)28-14/h4-10H,3,11H2,1-2H3,(H,21,25) |
| InChIKey | SLGBSMNKYXYDQQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|