About N-[1-(2,2-dimethylpropanoyl)-5-methylpiperidin-3-yl]acetamide
N-[1-(2,2-dimethylpropanoyl)-5-methylpiperidin-3-yl]acetamide (PubChem CID 112541844) has the molecular formula C13H24N2O2
and a molecular weight of 240.35 g/mol. Its IUPAC name is N-[1-(2,2-dimethylpropanoyl)-5-methylpiperidin-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[1-(2,2-dimethylpropanoyl)-5-methylpiperidin-3-yl]acetamide |
| PubChem CID | 112541844 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | N-[1-(2,2-dimethylpropanoyl)-5-methylpiperidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CC(C)CN(C(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C13H24N2O2/c1-9-6-11(14-10(2)16)8-15(7-9)12(17)13(3,4)5/h9,11H,6-8H2,1-5H3,(H,14,16) |
| InChIKey | BEVQZKIOTNBMJV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-(2,2-dimethylpropanoyl)-5-methylpiperidin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,2-dimethylpropanoyl)-5-methylpiperidin-3-yl]acetamide?
The IUPAC name of N-[1-(2,2-dimethylpropanoyl)-5-methylpiperidin-3-yl]acetamide (CID 112541844) is N-[1-(2,2-dimethylpropanoyl)-5-methylpiperidin-3-yl]acetamide.
What is the SMILES notation for N-[1-(2,2-dimethylpropanoyl)-5-methylpiperidin-3-yl]acetamide?
The canonical SMILES for N-[1-(2,2-dimethylpropanoyl)-5-methylpiperidin-3-yl]acetamide is CC(=O)NC1CC(C)CN(C(=O)C(C)(C)C)C1.
What is the InChIKey of N-[1-(2,2-dimethylpropanoyl)-5-methylpiperidin-3-yl]acetamide?
The InChIKey is BEVQZKIOTNBMJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O2/c1-9-6-11(14-10(2)16)8-15(7-9)12(17)13(3,4)5/h9,11H,6-8H2,1-5H3,(H,14,16).
What are the key properties of N-[1-(2,2-dimethylpropanoyl)-5-methylpiperidin-3-yl]acetamide?
N-[1-(2,2-dimethylpropanoyl)-5-methylpiperidin-3-yl]acetamide has a molecular weight of 240.35 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,2-dimethylpropanoyl)-5-methylpiperidin-3-yl]acetamide is sourced from PubChem (CID 112541844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).