C14H22N2O2S — CID 112543025
methyl N-[1-ethyl-5-(thiophen-2-ylmethyl)piperidin-3-yl]carbamate (PubChem CID 112543025) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is methyl N-[1-ethyl-5-(thiophen-2-ylmethyl)piperidin-3-yl]carbamate.
| Compound Name | methyl N-[1-ethyl-5-(thiophen-2-ylmethyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 112543025 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | methyl N-[1-ethyl-5-(thiophen-2-ylmethyl)piperidin-3-yl]carbamate |
| SMILES | CCN1CC(Cc2cccs2)CC(NC(=O)OC)C1 |
| InChI | InChI=1S/C14H22N2O2S/c1-3-16-9-11(8-13-5-4-6-19-13)7-12(10-16)15-14(17)18-2/h4-6,11-12H,3,7-10H2,1-2H3,(H,15,17) |
| InChIKey | PKOBCMMWYNVCCT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |