C17H30N2O2 — CID 112544027
ethyl N-[5-(cyclopropylmethyl)-1-(3-methylcyclobutyl)piperidin-3-yl]carbamate (PubChem CID 112544027) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is ethyl N-[5-(cyclopropylmethyl)-1-(3-methylcyclobutyl)piperidin-3-yl]carbamate.
| Compound Name | ethyl N-[5-(cyclopropylmethyl)-1-(3-methylcyclobutyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 112544027 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | ethyl N-[5-(cyclopropylmethyl)-1-(3-methylcyclobutyl)piperidin-3-yl]carbamate |
| SMILES | CCOC(=O)NC1CC(CC2CC2)CN(C2CC(C)C2)C1 |
| InChI | InChI=1S/C17H30N2O2/c1-3-21-17(20)18-15-9-14(8-13-4-5-13)10-19(11-15)16-6-12(2)7-16/h12-16H,3-11H2,1-2H3,(H,18,20) |
| InChIKey | KFJAWDFMNSAHHF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |