3-(4-methyl-2,5-dioxoimidazolidin-1-yl)butanoic acid

C8H12N2O4 — CID 112546497

IUPAC3-(4-methyl-2,5-dioxoimidazolidin-1-yl)butanoic acid
SMILESCC1NC(=O)N(C(C)CC(=O)O)C1=O
InChIInChI=1S/C8H12N2O4/c1-4(3-6(11)12)10-7(13)5(2)9-8(10)14/h4-5H,3H2,1-2H3,(H,9,14)(H,11,12)
InChIKeyALJKBKAFBOIMFI-UHFFFAOYSA-N
MW200.19 g/mol
LogP-0.21
Rot. Bonds3

About 3-(4-methyl-2,5-dioxoimidazolidin-1-yl)butanoic acid

3-(4-methyl-2,5-dioxoimidazolidin-1-yl)butanoic acid (PubChem CID 112546497) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is 3-(4-methyl-2,5-dioxoimidazolidin-1-yl)butanoic acid.

Molecular Properties

Compound Name3-(4-methyl-2,5-dioxoimidazolidin-1-yl)butanoic acid
PubChem CID112546497
Molecular FormulaC8H12N2O4
Molecular Weight200.19 g/mol
Exact Mass200.08
IUPAC Name3-(4-methyl-2,5-dioxoimidazolidin-1-yl)butanoic acid
SMILESCC1NC(=O)N(C(C)CC(=O)O)C1=O
InChIInChI=1S/C8H12N2O4/c1-4(3-6(11)12)10-7(13)5(2)9-8(10)14/h4-5H,3H2,1-2H3,(H,9,14)(H,11,12)
InChIKeyALJKBKAFBOIMFI-UHFFFAOYSA-N
XLogP-0.21
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.19
LogP ≤ 5-0.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydantoin', 'substructure': 'N/A'}

Analyze 3-(4-methyl-2,5-dioxoimidazolidin-1-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-methyl-2,5-dioxoimidazolidin-1-yl)butanoic acid?
The IUPAC name of 3-(4-methyl-2,5-dioxoimidazolidin-1-yl)butanoic acid (CID 112546497) is 3-(4-methyl-2,5-dioxoimidazolidin-1-yl)butanoic acid.
What is the SMILES notation for 3-(4-methyl-2,5-dioxoimidazolidin-1-yl)butanoic acid?
The canonical SMILES for 3-(4-methyl-2,5-dioxoimidazolidin-1-yl)butanoic acid is CC1NC(=O)N(C(C)CC(=O)O)C1=O.
What is the InChIKey of 3-(4-methyl-2,5-dioxoimidazolidin-1-yl)butanoic acid?
The InChIKey is ALJKBKAFBOIMFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4/c1-4(3-6(11)12)10-7(13)5(2)9-8(10)14/h4-5H,3H2,1-2H3,(H,9,14)(H,11,12).
What are the key properties of 3-(4-methyl-2,5-dioxoimidazolidin-1-yl)butanoic acid?
3-(4-methyl-2,5-dioxoimidazolidin-1-yl)butanoic acid has a molecular weight of 200.19 g/mol, XLogP of -0.21, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methyl-2,5-dioxoimidazolidin-1-yl)butanoic acid is sourced from PubChem (CID 112546497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).