About 3-(3-ethyl-2-oxo-1,3-diazinan-1-yl)-2-methylpropanoic acid
3-(3-ethyl-2-oxo-1,3-diazinan-1-yl)-2-methylpropanoic acid (PubChem CID 112546783) has the molecular formula C10H18N2O3
and a molecular weight of 214.26 g/mol. Its IUPAC name is 3-(3-ethyl-2-oxo-1,3-diazinan-1-yl)-2-methylpropanoic acid.
Analyze 3-(3-ethyl-2-oxo-1,3-diazinan-1-yl)-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-ethyl-2-oxo-1,3-diazinan-1-yl)-2-methylpropanoic acid?
The IUPAC name of 3-(3-ethyl-2-oxo-1,3-diazinan-1-yl)-2-methylpropanoic acid (CID 112546783) is 3-(3-ethyl-2-oxo-1,3-diazinan-1-yl)-2-methylpropanoic acid.
What is the SMILES notation for 3-(3-ethyl-2-oxo-1,3-diazinan-1-yl)-2-methylpropanoic acid?
The canonical SMILES for 3-(3-ethyl-2-oxo-1,3-diazinan-1-yl)-2-methylpropanoic acid is CCN1CCCN(CC(C)C(=O)O)C1=O.
What is the InChIKey of 3-(3-ethyl-2-oxo-1,3-diazinan-1-yl)-2-methylpropanoic acid?
The InChIKey is SRROFIUXGOGNSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O3/c1-3-11-5-4-6-12(10(11)15)7-8(2)9(13)14/h8H,3-7H2,1-2H3,(H,13,14).
What are the key properties of 3-(3-ethyl-2-oxo-1,3-diazinan-1-yl)-2-methylpropanoic acid?
3-(3-ethyl-2-oxo-1,3-diazinan-1-yl)-2-methylpropanoic acid has a molecular weight of 214.26 g/mol, XLogP of 0.85, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-ethyl-2-oxo-1,3-diazinan-1-yl)-2-methylpropanoic acid is sourced from PubChem (CID 112546783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).