About 5-pent-4-ynoxy-1H-indole
5-pent-4-ynoxy-1H-indole (PubChem CID 112548784) has the molecular formula C13H13NO
and a molecular weight of 199.25 g/mol. Its IUPAC name is 5-pent-4-ynoxy-1H-indole.
Molecular Properties
| Compound Name | 5-pent-4-ynoxy-1H-indole |
| PubChem CID | 112548784 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 5-pent-4-ynoxy-1H-indole |
| SMILES | C#CCCCOc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C13H13NO/c1-2-3-4-9-15-12-5-6-13-11(10-12)7-8-14-13/h1,5-8,10,14H,3-4,9H2 |
| InChIKey | IJSNCJLJTMCIGN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-pent-4-ynoxy-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pent-4-ynoxy-1H-indole?
The IUPAC name of 5-pent-4-ynoxy-1H-indole (CID 112548784) is 5-pent-4-ynoxy-1H-indole.
What is the SMILES notation for 5-pent-4-ynoxy-1H-indole?
The canonical SMILES for 5-pent-4-ynoxy-1H-indole is C#CCCCOc1ccc2[nH]ccc2c1.
What is the InChIKey of 5-pent-4-ynoxy-1H-indole?
The InChIKey is IJSNCJLJTMCIGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO/c1-2-3-4-9-15-12-5-6-13-11(10-12)7-8-14-13/h1,5-8,10,14H,3-4,9H2.
What are the key properties of 5-pent-4-ynoxy-1H-indole?
5-pent-4-ynoxy-1H-indole has a molecular weight of 199.25 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pent-4-ynoxy-1H-indole is sourced from PubChem (CID 112548784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).