About 5-heptoxy-1H-indole
5-heptoxy-1H-indole (PubChem CID 80642434) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is 5-heptoxy-1H-indole.
Molecular Properties
| Compound Name | 5-heptoxy-1H-indole |
| PubChem CID | 80642434 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 5-heptoxy-1H-indole |
| SMILES | CCCCCCCOc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C15H21NO/c1-2-3-4-5-6-11-17-14-7-8-15-13(12-14)9-10-16-15/h7-10,12,16H,2-6,11H2,1H3 |
| InChIKey | KSLOHQJPBPQMHX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-heptoxy-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-heptoxy-1H-indole?
The IUPAC name of 5-heptoxy-1H-indole (CID 80642434) is 5-heptoxy-1H-indole.
What is the SMILES notation for 5-heptoxy-1H-indole?
The canonical SMILES for 5-heptoxy-1H-indole is CCCCCCCOc1ccc2[nH]ccc2c1.
What is the InChIKey of 5-heptoxy-1H-indole?
The InChIKey is KSLOHQJPBPQMHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO/c1-2-3-4-5-6-11-17-14-7-8-15-13(12-14)9-10-16-15/h7-10,12,16H,2-6,11H2,1H3.
What are the key properties of 5-heptoxy-1H-indole?
5-heptoxy-1H-indole has a molecular weight of 231.34 g/mol, XLogP of 4.52, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-heptoxy-1H-indole is sourced from PubChem (CID 80642434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).