C15H26N4 — CID 112549288
N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine (PubChem CID 112549288) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine.
| Compound Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine |
|---|---|
| PubChem CID | 112549288 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine |
| SMILES | CCc1nn(C)cc1CNC1CCN2CCCC2C1 |
| InChI | InChI=1S/C15H26N4/c1-3-15-12(11-18(2)17-15)10-16-13-6-8-19-7-4-5-14(19)9-13/h11,13-14,16H,3-10H2,1-2H3 |
| InChIKey | HCQWMAIUBOIJOR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |