C18H29N3 — CID 124855746
(7R,8aS)-N-[[2-[ethyl(methyl)amino]phenyl]methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine (PubChem CID 124855746) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is (7R,8aS)-N-[[2-[ethyl(methyl)amino]phenyl]methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine.
| Compound Name | (7R,8aS)-N-[[2-[ethyl(methyl)amino]phenyl]methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine |
|---|---|
| PubChem CID | 124855746 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | (7R,8aS)-N-[[2-[ethyl(methyl)amino]phenyl]methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine |
| SMILES | CCN(C)c1ccccc1CN[C@@H]1CCN2CCC[C@H]2C1 |
| InChI | InChI=1S/C18H29N3/c1-3-20(2)18-9-5-4-7-15(18)14-19-16-10-12-21-11-6-8-17(21)13-16/h4-5,7,9,16-17,19H,3,6,8,10-14H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | AZAGKHNKHOSHAZ-SJORKVTESA-N |
| XLogP | 2.86 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |