C13H16BrN3OS — CID 112550092
5-bromo-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-methylthiophene-2-carboxamide (PubChem CID 112550092) has the molecular formula C13H16BrN3OS and a molecular weight of 342.26 g/mol. Its IUPAC name is 5-bromo-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-methylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 112550092 |
| Molecular Formula | C13H16BrN3OS |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 5-bromo-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-methylthiophene-2-carboxamide |
| SMILES | CCc1nn(C)cc1CNC(=O)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C13H16BrN3OS/c1-4-10-9(7-17(3)16-10)6-15-13(18)11-5-8(2)12(14)19-11/h5,7H,4,6H2,1-3H3,(H,15,18) |
| InChIKey | SYZBVXGFVIAEMH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |