C12H15N3OS2 — CID 107034233
N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-sulfanylthiophene-2-carboxamide (PubChem CID 107034233) has the molecular formula C12H15N3OS2 and a molecular weight of 281.41 g/mol. Its IUPAC name is N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107034233 |
| Molecular Formula | C12H15N3OS2 |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-sulfanylthiophene-2-carboxamide |
| SMILES | CCc1nn(C)cc1CNC(=O)c1cc(S)cs1 |
| InChI | InChI=1S/C12H15N3OS2/c1-3-10-8(6-15(2)14-10)5-13-12(16)11-4-9(17)7-18-11/h4,6-7,17H,3,5H2,1-2H3,(H,13,16) |
| InChIKey | CFZUOTNCXQQGFX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|