C9H10N4OS2 — CID 107027924
N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-4-sulfanylthiophene-2-carboxamide (PubChem CID 107027924) has the molecular formula C9H10N4OS2 and a molecular weight of 254.34 g/mol. Its IUPAC name is N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107027924 |
| Molecular Formula | C9H10N4OS2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-4-sulfanylthiophene-2-carboxamide |
| SMILES | Cn1cnnc1CNC(=O)c1cc(S)cs1 |
| InChI | InChI=1S/C9H10N4OS2/c1-13-5-11-12-8(13)3-10-9(14)7-2-6(15)4-16-7/h2,4-5,15H,3H2,1H3,(H,10,14) |
| InChIKey | DGUJQTXTEOLFLD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|