C9H12N4O5 — CID 112550431
N-(2-amino-2-oxoethoxy)-2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 112550431) has the molecular formula C9H12N4O5 and a molecular weight of 256.22 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 112550431 |
| Molecular Formula | C9H12N4O5 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | Cn1c(=O)ccn(CC(=O)NOCC(N)=O)c1=O |
| InChI | InChI=1S/C9H12N4O5/c1-12-8(16)2-3-13(9(12)17)4-7(15)11-18-5-6(10)14/h2-3H,4-5H2,1H3,(H2,10,14)(H,11,15) |
| InChIKey | WQYXRXVGTQTDDQ-UHFFFAOYSA-N |
| XLogP | -2.92 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|