C14H15N3O4 — CID 60562073
N-(2-hydroxy-5-methylphenyl)-2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 60562073) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is N-(2-hydroxy-5-methylphenyl)-2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N-(2-hydroxy-5-methylphenyl)-2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 60562073 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-(2-hydroxy-5-methylphenyl)-2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | Cc1ccc(O)c(NC(=O)Cn2ccc(=O)n(C)c2=O)c1 |
| InChI | InChI=1S/C14H15N3O4/c1-9-3-4-11(18)10(7-9)15-12(19)8-17-6-5-13(20)16(2)14(17)21/h3-7,18H,8H2,1-2H3,(H,15,19) |
| InChIKey | OOMSWXXRPTXGPZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|