C9H11N3O4 — CID 112550755
N-(2-amino-2-oxoethoxy)-6-methoxypyridine-3-carboxamide (PubChem CID 112550755) has the molecular formula C9H11N3O4 and a molecular weight of 225.20 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-6-methoxypyridine-3-carboxamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-6-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 112550755 |
| Molecular Formula | C9H11N3O4 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-6-methoxypyridine-3-carboxamide |
| SMILES | COc1ccc(C(=O)NOCC(N)=O)cn1 |
| InChI | InChI=1S/C9H11N3O4/c1-15-8-3-2-6(4-11-8)9(14)12-16-5-7(10)13/h2-4H,5H2,1H3,(H2,10,13)(H,12,14) |
| InChIKey | OIALTDCSPLDBTN-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|