C9H13N3O5 — CID 112551078
N-(2-amino-2-oxoethoxy)-3-(2,5-dioxopyrrolidin-1-yl)propanamide (PubChem CID 112551078) has the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-3-(2,5-dioxopyrrolidin-1-yl)propanamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-3-(2,5-dioxopyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 112551078 |
| Molecular Formula | C9H13N3O5 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-3-(2,5-dioxopyrrolidin-1-yl)propanamide |
| SMILES | NC(=O)CONC(=O)CCN1C(=O)CCC1=O |
| InChI | InChI=1S/C9H13N3O5/c10-6(13)5-17-11-7(14)3-4-12-8(15)1-2-9(12)16/h1-5H2,(H2,10,13)(H,11,14) |
| InChIKey | UCFHTAVYLVUEAB-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|