C11H15N3O5 — CID 112551984
2-amino-N,N-bis(2-hydroxyethyl)-3-nitrobenzamide (PubChem CID 112551984) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is 2-amino-N,N-bis(2-hydroxyethyl)-3-nitrobenzamide.
| Compound Name | 2-amino-N,N-bis(2-hydroxyethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 112551984 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 2-amino-N,N-bis(2-hydroxyethyl)-3-nitrobenzamide |
| SMILES | Nc1c(C(=O)N(CCO)CCO)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15N3O5/c12-10-8(2-1-3-9(10)14(18)19)11(17)13(4-6-15)5-7-16/h1-3,15-16H,4-7,12H2 |
| InChIKey | RRQFHRHZEKNFDO-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|