C9H9ClN2O2S — CID 112552052
3,8-dimethylimidazo[1,5-a]pyridine-1-sulfonyl chloride (PubChem CID 112552052) has the molecular formula C9H9ClN2O2S and a molecular weight of 244.70 g/mol. Its IUPAC name is 3,8-dimethylimidazo[1,5-a]pyridine-1-sulfonyl chloride.
| Compound Name | 3,8-dimethylimidazo[1,5-a]pyridine-1-sulfonyl chloride |
|---|---|
| PubChem CID | 112552052 |
| Molecular Formula | C9H9ClN2O2S |
| Molecular Weight | 244.70 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 3,8-dimethylimidazo[1,5-a]pyridine-1-sulfonyl chloride |
| SMILES | Cc1cccn2c(C)nc(S(=O)(=O)Cl)c12 |
| InChI | InChI=1S/C9H9ClN2O2S/c1-6-4-3-5-12-7(2)11-9(8(6)12)15(10,13)14/h3-5H,1-2H3 |
| InChIKey | PBYOOPLMBYAGDF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.70 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |