C10H13N3 — CID 83827526
(3,8-dimethylimidazo[1,5-a]pyridin-1-yl)methanamine (PubChem CID 83827526) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is (3,8-dimethylimidazo[1,5-a]pyridin-1-yl)methanamine.
| Compound Name | (3,8-dimethylimidazo[1,5-a]pyridin-1-yl)methanamine |
|---|---|
| PubChem CID | 83827526 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | (3,8-dimethylimidazo[1,5-a]pyridin-1-yl)methanamine |
| SMILES | Cc1cccn2c(C)nc(CN)c12 |
| InChI | InChI=1S/C10H13N3/c1-7-4-3-5-13-8(2)12-9(6-11)10(7)13/h3-5H,6,11H2,1-2H3 |
| InChIKey | CPHMZFVWDAMLSR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |