C14H13N3 — CID 83870977
8-methyl-3-phenylimidazo[1,5-a]pyridin-1-amine (PubChem CID 83870977) has the molecular formula C14H13N3 and a molecular weight of 223.28 g/mol. Its IUPAC name is 8-methyl-3-phenylimidazo[1,5-a]pyridin-1-amine.
| Compound Name | 8-methyl-3-phenylimidazo[1,5-a]pyridin-1-amine |
|---|---|
| PubChem CID | 83870977 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 8-methyl-3-phenylimidazo[1,5-a]pyridin-1-amine |
| SMILES | Cc1cccn2c(-c3ccccc3)nc(N)c12 |
| InChI | InChI=1S/C14H13N3/c1-10-6-5-9-17-12(10)13(15)16-14(17)11-7-3-2-4-8-11/h2-9H,15H2,1H3 |
| InChIKey | CGWGKQAQIRHBGT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |