C15H14BrN3 — CID 84744532
1-bromo-N,N-dimethyl-3-phenylimidazo[1,5-a]pyridin-8-amine (PubChem CID 84744532) has the molecular formula C15H14BrN3 and a molecular weight of 316.20 g/mol. Its IUPAC name is 1-bromo-N,N-dimethyl-3-phenylimidazo[1,5-a]pyridin-8-amine.
| Compound Name | 1-bromo-N,N-dimethyl-3-phenylimidazo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 84744532 |
| Molecular Formula | C15H14BrN3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 1-bromo-N,N-dimethyl-3-phenylimidazo[1,5-a]pyridin-8-amine |
| SMILES | CN(C)c1cccn2c(-c3ccccc3)nc(Br)c12 |
| InChI | InChI=1S/C15H14BrN3/c1-18(2)12-9-6-10-19-13(12)14(16)17-15(19)11-7-4-3-5-8-11/h3-10H,1-2H3 |
| InChIKey | ROXIULZRKYPVLQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |