C15H15N3 — CID 83842559
(1-methyl-3-phenylimidazo[1,5-a]pyridin-8-yl)methanamine (PubChem CID 83842559) has the molecular formula C15H15N3 and a molecular weight of 237.31 g/mol. Its IUPAC name is (1-methyl-3-phenylimidazo[1,5-a]pyridin-8-yl)methanamine.
| Compound Name | (1-methyl-3-phenylimidazo[1,5-a]pyridin-8-yl)methanamine |
|---|---|
| PubChem CID | 83842559 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | (1-methyl-3-phenylimidazo[1,5-a]pyridin-8-yl)methanamine |
| SMILES | Cc1nc(-c2ccccc2)n2cccc(CN)c12 |
| InChI | InChI=1S/C15H15N3/c1-11-14-13(10-16)8-5-9-18(14)15(17-11)12-6-3-2-4-7-12/h2-9H,10,16H2,1H3 |
| InChIKey | IYOGOPYEHRBZAI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |