C11H13N3O2S — CID 112552138
N-cyclopropyl-3-methylimidazo[1,5-a]pyridine-1-sulfonamide (PubChem CID 112552138) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is N-cyclopropyl-3-methylimidazo[1,5-a]pyridine-1-sulfonamide.
| Compound Name | N-cyclopropyl-3-methylimidazo[1,5-a]pyridine-1-sulfonamide |
|---|---|
| PubChem CID | 112552138 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | N-cyclopropyl-3-methylimidazo[1,5-a]pyridine-1-sulfonamide |
| SMILES | Cc1nc(S(=O)(=O)NC2CC2)c2ccccn12 |
| InChI | InChI=1S/C11H13N3O2S/c1-8-12-11(10-4-2-3-7-14(8)10)17(15,16)13-9-5-6-9/h2-4,7,9,13H,5-6H2,1H3 |
| InChIKey | IKVIFBSRWBLRDN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |