C10H13N3O3S — CID 112552261
3-ethyl-5-methoxyimidazo[1,5-a]pyridine-1-sulfonamide (PubChem CID 112552261) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is 3-ethyl-5-methoxyimidazo[1,5-a]pyridine-1-sulfonamide.
| Compound Name | 3-ethyl-5-methoxyimidazo[1,5-a]pyridine-1-sulfonamide |
|---|---|
| PubChem CID | 112552261 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-ethyl-5-methoxyimidazo[1,5-a]pyridine-1-sulfonamide |
| SMILES | CCc1nc(S(N)(=O)=O)c2cccc(OC)n12 |
| InChI | InChI=1S/C10H13N3O3S/c1-3-8-12-10(17(11,14)15)7-5-4-6-9(16-2)13(7)8/h4-6H,3H2,1-2H3,(H2,11,14,15) |
| InChIKey | PSGYKDMVCXBOLU-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |