C9H8Br2N2 — CID 84744172
1,5-dibromo-3-ethylimidazo[1,5-a]pyridine (PubChem CID 84744172) has the molecular formula C9H8Br2N2 and a molecular weight of 303.99 g/mol. Its IUPAC name is 1,5-dibromo-3-ethylimidazo[1,5-a]pyridine.
| Compound Name | 1,5-dibromo-3-ethylimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 84744172 |
| Molecular Formula | C9H8Br2N2 |
| Molecular Weight | 303.99 g/mol |
| Exact Mass | 301.91 |
| IUPAC Name | 1,5-dibromo-3-ethylimidazo[1,5-a]pyridine |
| SMILES | CCc1nc(Br)c2cccc(Br)n12 |
| InChI | InChI=1S/C9H8Br2N2/c1-2-8-12-9(11)6-4-3-5-7(10)13(6)8/h3-5H,2H2,1H3 |
| InChIKey | STBNCFZABBLULT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.99 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|