C10H10BrN3O — CID 84743006
3-(2-aminoethyl)-5-bromoimidazo[1,5-a]pyridine-1-carbaldehyde (PubChem CID 84743006) has the molecular formula C10H10BrN3O and a molecular weight of 268.11 g/mol. Its IUPAC name is 3-(2-aminoethyl)-5-bromoimidazo[1,5-a]pyridine-1-carbaldehyde.
| Compound Name | 3-(2-aminoethyl)-5-bromoimidazo[1,5-a]pyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 84743006 |
| Molecular Formula | C10H10BrN3O |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | 3-(2-aminoethyl)-5-bromoimidazo[1,5-a]pyridine-1-carbaldehyde |
| SMILES | NCCc1nc(C=O)c2cccc(Br)n12 |
| InChI | InChI=1S/C10H10BrN3O/c11-9-3-1-2-8-7(6-15)13-10(4-5-12)14(8)9/h1-3,6H,4-5,12H2 |
| InChIKey | QAMLCIFHARBQLF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|