C9H10BrN3 — CID 83843084
2-(5-bromoimidazo[1,5-a]pyridin-3-yl)ethanamine (PubChem CID 83843084) has the molecular formula C9H10BrN3 and a molecular weight of 240.10 g/mol. Its IUPAC name is 2-(5-bromoimidazo[1,5-a]pyridin-3-yl)ethanamine.
| Compound Name | 2-(5-bromoimidazo[1,5-a]pyridin-3-yl)ethanamine |
|---|---|
| PubChem CID | 83843084 |
| Molecular Formula | C9H10BrN3 |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 2-(5-bromoimidazo[1,5-a]pyridin-3-yl)ethanamine |
| SMILES | NCCc1ncc2cccc(Br)n12 |
| InChI | InChI=1S/C9H10BrN3/c10-8-3-1-2-7-6-12-9(4-5-11)13(7)8/h1-3,6H,4-5,11H2 |
| InChIKey | DFKQRHRFDOTBAX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|