C8H10N4 — CID 84651411
2-imidazo[1,5-b]pyridazin-7-ylethanamine (PubChem CID 84651411) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 2-imidazo[1,5-b]pyridazin-7-ylethanamine.
| Compound Name | 2-imidazo[1,5-b]pyridazin-7-ylethanamine |
|---|---|
| PubChem CID | 84651411 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2-imidazo[1,5-b]pyridazin-7-ylethanamine |
| SMILES | NCCc1ncc2cccnn12 |
| InChI | InChI=1S/C8H10N4/c9-4-3-8-10-6-7-2-1-5-11-12(7)8/h1-2,5-6H,3-4,9H2 |
| InChIKey | FPHGYWIOUGOFBG-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |