C9H10ClN3 — CID 83831117
2-(3-chloroimidazo[1,5-a]pyridin-5-yl)ethanamine (PubChem CID 83831117) has the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. Its IUPAC name is 2-(3-chloroimidazo[1,5-a]pyridin-5-yl)ethanamine.
| Compound Name | 2-(3-chloroimidazo[1,5-a]pyridin-5-yl)ethanamine |
|---|---|
| PubChem CID | 83831117 |
| Molecular Formula | C9H10ClN3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 2-(3-chloroimidazo[1,5-a]pyridin-5-yl)ethanamine |
| SMILES | NCCc1cccc2cnc(Cl)n12 |
| InChI | InChI=1S/C9H10ClN3/c10-9-12-6-8-3-1-2-7(4-5-11)13(8)9/h1-3,6H,4-5,11H2 |
| InChIKey | MYCHGYJHYVSLRB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |