C9H10FN3 — CID 105437923
2-(5-fluoroimidazo[1,2-a]pyridin-3-yl)ethanamine (PubChem CID 105437923) has the molecular formula C9H10FN3 and a molecular weight of 179.20 g/mol. Its IUPAC name is 2-(5-fluoroimidazo[1,2-a]pyridin-3-yl)ethanamine.
| Compound Name | 2-(5-fluoroimidazo[1,2-a]pyridin-3-yl)ethanamine |
|---|---|
| PubChem CID | 105437923 |
| Molecular Formula | C9H10FN3 |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-(5-fluoroimidazo[1,2-a]pyridin-3-yl)ethanamine |
| SMILES | NCCc1cnc2cccc(F)n12 |
| InChI | InChI=1S/C9H10FN3/c10-8-2-1-3-9-12-6-7(4-5-11)13(8)9/h1-3,6H,4-5,11H2 |
| InChIKey | SBLXKJCJYRDEDJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|