C10H12BrN3 — CID 117255863
1-(5-bromoimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine (PubChem CID 117255863) has the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. Its IUPAC name is 1-(5-bromoimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(5-bromoimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 117255863 |
| Molecular Formula | C10H12BrN3 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 1-(5-bromoimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1cnc2cccc(Br)n12 |
| InChI | InChI=1S/C10H12BrN3/c1-13(2)7-8-6-12-10-5-3-4-9(11)14(8)10/h3-6H,7H2,1-2H3 |
| InChIKey | CIIKDCFZJWLLKO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|