About 1-bromo-9-chloroimidazo[1,2-a]quinoline
1-bromo-9-chloroimidazo[1,2-a]quinoline (PubChem CID 115051776) has the molecular formula C11H6BrClN2
and a molecular weight of 281.54 g/mol. Its IUPAC name is 1-bromo-9-chloroimidazo[1,2-a]quinoline.
Molecular Properties
| Compound Name | 1-bromo-9-chloroimidazo[1,2-a]quinoline |
| PubChem CID | 115051776 |
| Molecular Formula | C11H6BrClN2 |
| Molecular Weight | 281.54 g/mol |
| Exact Mass | 279.94 |
| IUPAC Name | 1-bromo-9-chloroimidazo[1,2-a]quinoline |
| SMILES | Clc1cccc2ccc3ncc(Br)n3c12 |
| InChI | InChI=1S/C11H6BrClN2/c12-9-6-14-10-5-4-7-2-1-3-8(13)11(7)15(9)10/h1-6H |
| InChIKey | JTRASRWKXIOLBT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bromo-9-chloroimidazo[1,2-a]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-9-chloroimidazo[1,2-a]quinoline?
The IUPAC name of 1-bromo-9-chloroimidazo[1,2-a]quinoline (CID 115051776) is 1-bromo-9-chloroimidazo[1,2-a]quinoline.
What is the SMILES notation for 1-bromo-9-chloroimidazo[1,2-a]quinoline?
The canonical SMILES for 1-bromo-9-chloroimidazo[1,2-a]quinoline is Clc1cccc2ccc3ncc(Br)n3c12.
What is the InChIKey of 1-bromo-9-chloroimidazo[1,2-a]quinoline?
The InChIKey is JTRASRWKXIOLBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6BrClN2/c12-9-6-14-10-5-4-7-2-1-3-8(13)11(7)15(9)10/h1-6H.
What are the key properties of 1-bromo-9-chloroimidazo[1,2-a]quinoline?
1-bromo-9-chloroimidazo[1,2-a]quinoline has a molecular weight of 281.54 g/mol, XLogP of 3.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-9-chloroimidazo[1,2-a]quinoline is sourced from PubChem (CID 115051776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).