C10H13N3O — CID 105445012
2-(5-methoxyimidazo[1,5-a]pyridin-3-yl)ethanamine (PubChem CID 105445012) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-(5-methoxyimidazo[1,5-a]pyridin-3-yl)ethanamine.
| Compound Name | 2-(5-methoxyimidazo[1,5-a]pyridin-3-yl)ethanamine |
|---|---|
| PubChem CID | 105445012 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-(5-methoxyimidazo[1,5-a]pyridin-3-yl)ethanamine |
| SMILES | COc1cccc2cnc(CCN)n12 |
| InChI | InChI=1S/C10H13N3O/c1-14-10-4-2-3-8-7-12-9(5-6-11)13(8)10/h2-4,7H,5-6,11H2,1H3 |
| InChIKey | QAFCZMCPJMLMRF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |