C14H18BrN3 — CID 117141395
5-bromo-3-[(1-ethylpyrrolidin-3-yl)methyl]imidazo[1,5-a]pyridine (PubChem CID 117141395) has the molecular formula C14H18BrN3 and a molecular weight of 308.22 g/mol. Its IUPAC name is 5-bromo-3-[(1-ethylpyrrolidin-3-yl)methyl]imidazo[1,5-a]pyridine.
| Compound Name | 5-bromo-3-[(1-ethylpyrrolidin-3-yl)methyl]imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117141395 |
| Molecular Formula | C14H18BrN3 |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 5-bromo-3-[(1-ethylpyrrolidin-3-yl)methyl]imidazo[1,5-a]pyridine |
| SMILES | CCN1CCC(Cc2ncc3cccc(Br)n23)C1 |
| InChI | InChI=1S/C14H18BrN3/c1-2-17-7-6-11(10-17)8-14-16-9-12-4-3-5-13(15)18(12)14/h3-5,9,11H,2,6-8,10H2,1H3 |
| InChIKey | SRLQERJHDZKWDK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|