C16H13BrN2O2 — CID 84745312
5-bromo-3-[(4-methoxyphenyl)methyl]imidazo[1,5-a]pyridine-1-carbaldehyde (PubChem CID 84745312) has the molecular formula C16H13BrN2O2 and a molecular weight of 345.20 g/mol. Its IUPAC name is 5-bromo-3-[(4-methoxyphenyl)methyl]imidazo[1,5-a]pyridine-1-carbaldehyde.
| Compound Name | 5-bromo-3-[(4-methoxyphenyl)methyl]imidazo[1,5-a]pyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 84745312 |
| Molecular Formula | C16H13BrN2O2 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 5-bromo-3-[(4-methoxyphenyl)methyl]imidazo[1,5-a]pyridine-1-carbaldehyde |
| SMILES | COc1ccc(Cc2nc(C=O)c3cccc(Br)n23)cc1 |
| InChI | InChI=1S/C16H13BrN2O2/c1-21-12-7-5-11(6-8-12)9-16-18-13(10-20)14-3-2-4-15(17)19(14)16/h2-8,10H,9H2,1H3 |
| InChIKey | MIOCZLNVGINNJH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|