C9H4BrF3N2O — CID 84743818
5-bromo-3-(trifluoromethyl)imidazo[1,5-a]pyridine-1-carbaldehyde (PubChem CID 84743818) has the molecular formula C9H4BrF3N2O and a molecular weight of 293.04 g/mol. Its IUPAC name is 5-bromo-3-(trifluoromethyl)imidazo[1,5-a]pyridine-1-carbaldehyde.
| Compound Name | 5-bromo-3-(trifluoromethyl)imidazo[1,5-a]pyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 84743818 |
| Molecular Formula | C9H4BrF3N2O |
| Molecular Weight | 293.04 g/mol |
| Exact Mass | 291.95 |
| IUPAC Name | 5-bromo-3-(trifluoromethyl)imidazo[1,5-a]pyridine-1-carbaldehyde |
| SMILES | O=Cc1nc(C(F)(F)F)n2c(Br)cccc12 |
| InChI | InChI=1S/C9H4BrF3N2O/c10-7-3-1-2-6-5(4-16)14-8(15(6)7)9(11,12)13/h1-4H |
| InChIKey | UPVCKUHZIWQXIU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.04 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|