C9H7BrFN3O — CID 164594561
6-bromo-5-fluoro-N-methylimidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 164594561) has the molecular formula C9H7BrFN3O and a molecular weight of 272.08 g/mol. Its IUPAC name is 6-bromo-5-fluoro-N-methylimidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | 6-bromo-5-fluoro-N-methylimidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 164594561 |
| Molecular Formula | C9H7BrFN3O |
| Molecular Weight | 272.08 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 6-bromo-5-fluoro-N-methylimidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | CNC(=O)c1ncn2c(F)c(Br)ccc12 |
| InChI | InChI=1S/C9H7BrFN3O/c1-12-9(15)7-6-3-2-5(10)8(11)14(6)4-13-7/h2-4H,1H3,(H,12,15) |
| InChIKey | XULLKXDOVXODJH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.08 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|