About 4-bromo-N-methyl-2,1,3-benzothiadiazole-7-carboxamide
4-bromo-N-methyl-2,1,3-benzothiadiazole-7-carboxamide (PubChem CID 59409553) has the molecular formula C8H6BrN3OS
and a molecular weight of 272.13 g/mol. Its IUPAC name is 4-bromo-N-methyl-2,1,3-benzothiadiazole-7-carboxamide.
Molecular Properties
| Compound Name | 4-bromo-N-methyl-2,1,3-benzothiadiazole-7-carboxamide |
| PubChem CID | 59409553 |
| Molecular Formula | C8H6BrN3OS |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 270.94 |
| IUPAC Name | 4-bromo-N-methyl-2,1,3-benzothiadiazole-7-carboxamide |
| SMILES | CNC(=O)c1ccc(Br)c2nsnc12 |
| InChI | InChI=1S/C8H6BrN3OS/c1-10-8(13)4-2-3-5(9)7-6(4)11-14-12-7/h2-3H,1H3,(H,10,13) |
| InChIKey | YNUOCPIHIGQFTD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-N-methyl-2,1,3-benzothiadiazole-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-methyl-2,1,3-benzothiadiazole-7-carboxamide?
The IUPAC name of 4-bromo-N-methyl-2,1,3-benzothiadiazole-7-carboxamide (CID 59409553) is 4-bromo-N-methyl-2,1,3-benzothiadiazole-7-carboxamide.
What is the SMILES notation for 4-bromo-N-methyl-2,1,3-benzothiadiazole-7-carboxamide?
The canonical SMILES for 4-bromo-N-methyl-2,1,3-benzothiadiazole-7-carboxamide is CNC(=O)c1ccc(Br)c2nsnc12.
What is the InChIKey of 4-bromo-N-methyl-2,1,3-benzothiadiazole-7-carboxamide?
The InChIKey is YNUOCPIHIGQFTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrN3OS/c1-10-8(13)4-2-3-5(9)7-6(4)11-14-12-7/h2-3H,1H3,(H,10,13).
What are the key properties of 4-bromo-N-methyl-2,1,3-benzothiadiazole-7-carboxamide?
4-bromo-N-methyl-2,1,3-benzothiadiazole-7-carboxamide has a molecular weight of 272.13 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-methyl-2,1,3-benzothiadiazole-7-carboxamide is sourced from PubChem (CID 59409553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).