C9H7ClN2OS — CID 119090275
2-chloro-N-methyl-1,3-benzothiazole-4-carboxamide (PubChem CID 119090275) has the molecular formula C9H7ClN2OS and a molecular weight of 226.69 g/mol. Its IUPAC name is 2-chloro-N-methyl-1,3-benzothiazole-4-carboxamide.
| Compound Name | 2-chloro-N-methyl-1,3-benzothiazole-4-carboxamide |
|---|---|
| PubChem CID | 119090275 |
| Molecular Formula | C9H7ClN2OS |
| Molecular Weight | 226.69 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 2-chloro-N-methyl-1,3-benzothiazole-4-carboxamide |
| SMILES | CNC(=O)c1cccc2sc(Cl)nc12 |
| InChI | InChI=1S/C9H7ClN2OS/c1-11-8(13)5-3-2-4-6-7(5)12-9(10)14-6/h2-4H,1H3,(H,11,13) |
| InChIKey | BEHZXURRPCSPKC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.69 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |