C10H10ClFN2 — CID 112552859
1-(chloromethyl)-3-ethyl-8-fluoroimidazo[1,5-a]pyridine (PubChem CID 112552859) has the molecular formula C10H10ClFN2 and a molecular weight of 212.66 g/mol. Its IUPAC name is 1-(chloromethyl)-3-ethyl-8-fluoroimidazo[1,5-a]pyridine.
| Compound Name | 1-(chloromethyl)-3-ethyl-8-fluoroimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 112552859 |
| Molecular Formula | C10H10ClFN2 |
| Molecular Weight | 212.66 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 1-(chloromethyl)-3-ethyl-8-fluoroimidazo[1,5-a]pyridine |
| SMILES | CCc1nc(CCl)c2c(F)cccn12 |
| InChI | InChI=1S/C10H10ClFN2/c1-2-9-13-8(6-11)10-7(12)4-3-5-14(9)10/h3-5H,2,6H2,1H3 |
| InChIKey | BMEBEJBWEYWYJU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.66 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|