C12H17N3 — CID 66693871
1,3,8-triethylimidazo[1,5-a]pyrazine (PubChem CID 66693871) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 1,3,8-triethylimidazo[1,5-a]pyrazine.
| Compound Name | 1,3,8-triethylimidazo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 66693871 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 1,3,8-triethylimidazo[1,5-a]pyrazine |
| SMILES | CCc1nccn2c(CC)nc(CC)c12 |
| InChI | InChI=1S/C12H17N3/c1-4-9-12-10(5-2)14-11(6-3)15(12)8-7-13-9/h7-8H,4-6H2,1-3H3 |
| InChIKey | FNJMVZGUXBZZJA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |