C9H12N4 — CID 166808466
1-ethyl-3-methylimidazo[1,5-a]pyrazin-8-amine (PubChem CID 166808466) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-ethyl-3-methylimidazo[1,5-a]pyrazin-8-amine.
| Compound Name | 1-ethyl-3-methylimidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 166808466 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 1-ethyl-3-methylimidazo[1,5-a]pyrazin-8-amine |
| SMILES | CCc1nc(C)n2ccnc(N)c12 |
| InChI | InChI=1S/C9H12N4/c1-3-7-8-9(10)11-4-5-13(8)6(2)12-7/h4-5H,3H2,1-2H3,(H2,10,11) |
| InChIKey | RNKUYYIBTAGBBV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |