C11H15N3 — CID 178092821
8-methyl-6-propan-2-ylpyrrolo[1,2-a]pyrazin-1-amine (PubChem CID 178092821) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 8-methyl-6-propan-2-ylpyrrolo[1,2-a]pyrazin-1-amine.
| Compound Name | 8-methyl-6-propan-2-ylpyrrolo[1,2-a]pyrazin-1-amine |
|---|---|
| PubChem CID | 178092821 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 8-methyl-6-propan-2-ylpyrrolo[1,2-a]pyrazin-1-amine |
| SMILES | Cc1cc(C(C)C)n2ccnc(N)c12 |
| InChI | InChI=1S/C11H15N3/c1-7(2)9-6-8(3)10-11(12)13-4-5-14(9)10/h4-7H,1-3H3,(H2,12,13) |
| InChIKey | JPGRVSLRKHEZKF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |